C13H16IN3 — CID 115822187
2-(1-ethylpyrazol-4-yl)-1-(3-iodophenyl)ethanamine (PubChem CID 115822187) has the molecular formula C13H16IN3 and a molecular weight of 341.20 g/mol. Its IUPAC name is 2-(1-ethylpyrazol-4-yl)-1-(3-iodophenyl)ethanamine.
| Compound Name | 2-(1-ethylpyrazol-4-yl)-1-(3-iodophenyl)ethanamine |
|---|---|
| PubChem CID | 115822187 |
| Molecular Formula | C13H16IN3 |
| Molecular Weight | 341.20 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 2-(1-ethylpyrazol-4-yl)-1-(3-iodophenyl)ethanamine |
| SMILES | CCn1cc(CC(N)c2cccc(I)c2)cn1 |
| InChI | InChI=1S/C13H16IN3/c1-2-17-9-10(8-16-17)6-13(15)11-4-3-5-12(14)7-11/h3-5,7-9,13H,2,6,15H2,1H3 |
| InChIKey | LOQOGIODHSYIJO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.20 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|