C15H15Br2NO — CID 115822341
1-(2,5-dibromophenyl)-2-(5-ethyl-2-pyridinyl)ethanol (PubChem CID 115822341) has the molecular formula C15H15Br2NO and a molecular weight of 385.10 g/mol. Its IUPAC name is 1-(2,5-dibromophenyl)-2-(5-ethyl-2-pyridinyl)ethanol.
| Compound Name | 1-(2,5-dibromophenyl)-2-(5-ethyl-2-pyridinyl)ethanol |
|---|---|
| PubChem CID | 115822341 |
| Molecular Formula | C15H15Br2NO |
| Molecular Weight | 385.10 g/mol |
| Exact Mass | 382.95 |
| IUPAC Name | 1-(2,5-dibromophenyl)-2-(5-ethyl-2-pyridinyl)ethanol |
| SMILES | CCc1ccc(CC(O)c2cc(Br)ccc2Br)nc1 |
| InChI | InChI=1S/C15H15Br2NO/c1-2-10-3-5-12(18-9-10)8-15(19)13-7-11(16)4-6-14(13)17/h3-7,9,15,19H,2,8H2,1H3 |
| InChIKey | JXCUXHSXVWHPHT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.10 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |