About 1-(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)-3-(2-phenylcyclopropyl)urea
1-(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)-3-(2-phenylcyclopropyl)urea (PubChem CID 11582499) has the molecular formula C23H18FN3O2S
and a molecular weight of 419.48 g/mol. Its IUPAC name is 1-(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)-3-(2-phenylcyclopropyl)urea.
Molecular Properties
| Compound Name | 1-(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)-3-(2-phenylcyclopropyl)urea |
| PubChem CID | 11582499 |
| Molecular Formula | C23H18FN3O2S |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 1-(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)-3-(2-phenylcyclopropyl)urea |
| SMILES | O=C(Nc1ccc(Oc2ccnc3ccsc23)c(F)c1)NC1CC1c1ccccc1 |
| InChI | InChI=1S/C23H18FN3O2S/c24-17-12-15(26-23(28)27-19-13-16(19)14-4-2-1-3-5-14)6-7-20(17)29-21-8-10-25-18-9-11-30-22(18)21/h1-12,16,19H,13H2,(H2,26,27,28) |
| InChIKey | ZCYRUSHHGCLGOQ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)-3-(2-phenylcyclopropyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)-3-(2-phenylcyclopropyl)urea?
The IUPAC name of 1-(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)-3-(2-phenylcyclopropyl)urea (CID 11582499) is 1-(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)-3-(2-phenylcyclopropyl)urea.
What is the SMILES notation for 1-(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)-3-(2-phenylcyclopropyl)urea?
The canonical SMILES for 1-(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)-3-(2-phenylcyclopropyl)urea is O=C(Nc1ccc(Oc2ccnc3ccsc23)c(F)c1)NC1CC1c1ccccc1.
What is the InChIKey of 1-(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)-3-(2-phenylcyclopropyl)urea?
The InChIKey is ZCYRUSHHGCLGOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18FN3O2S/c24-17-12-15(26-23(28)27-19-13-16(19)14-4-2-1-3-5-14)6-7-20(17)29-21-8-10-25-18-9-11-30-22(18)21/h1-12,16,19H,13H2,(H2,26,27,28).
What are the key properties of 1-(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)-3-(2-phenylcyclopropyl)urea?
1-(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)-3-(2-phenylcyclopropyl)urea has a molecular weight of 419.48 g/mol, XLogP of 5.91, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)-3-(2-phenylcyclopropyl)urea is sourced from PubChem (CID 11582499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).