About 3-(4-methyl-2,5-dioxopiperazin-1-yl)propanenitrile
3-(4-methyl-2,5-dioxopiperazin-1-yl)propanenitrile (PubChem CID 115825058) has the molecular formula C8H11N3O2
and a molecular weight of 181.19 g/mol. Its IUPAC name is 3-(4-methyl-2,5-dioxopiperazin-1-yl)propanenitrile.
Molecular Properties
| Compound Name | 3-(4-methyl-2,5-dioxopiperazin-1-yl)propanenitrile |
| PubChem CID | 115825058 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 3-(4-methyl-2,5-dioxopiperazin-1-yl)propanenitrile |
| SMILES | CN1CC(=O)N(CCC#N)CC1=O |
| InChI | InChI=1S/C8H11N3O2/c1-10-5-8(13)11(4-2-3-9)6-7(10)12/h2,4-6H2,1H3 |
| InChIKey | LVHCTCBEEMEUJT-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-methyl-2,5-dioxopiperazin-1-yl)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methyl-2,5-dioxopiperazin-1-yl)propanenitrile?
The IUPAC name of 3-(4-methyl-2,5-dioxopiperazin-1-yl)propanenitrile (CID 115825058) is 3-(4-methyl-2,5-dioxopiperazin-1-yl)propanenitrile.
What is the SMILES notation for 3-(4-methyl-2,5-dioxopiperazin-1-yl)propanenitrile?
The canonical SMILES for 3-(4-methyl-2,5-dioxopiperazin-1-yl)propanenitrile is CN1CC(=O)N(CCC#N)CC1=O.
What is the InChIKey of 3-(4-methyl-2,5-dioxopiperazin-1-yl)propanenitrile?
The InChIKey is LVHCTCBEEMEUJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O2/c1-10-5-8(13)11(4-2-3-9)6-7(10)12/h2,4-6H2,1H3.
What are the key properties of 3-(4-methyl-2,5-dioxopiperazin-1-yl)propanenitrile?
3-(4-methyl-2,5-dioxopiperazin-1-yl)propanenitrile has a molecular weight of 181.19 g/mol, XLogP of -0.80, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methyl-2,5-dioxopiperazin-1-yl)propanenitrile is sourced from PubChem (CID 115825058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).