C15H10Br2OS — CID 115827334
1-benzothiophen-7-yl-(2,5-dibromophenyl)methanol (PubChem CID 115827334) has the molecular formula C15H10Br2OS and a molecular weight of 398.12 g/mol. Its IUPAC name is 1-benzothiophen-7-yl-(2,5-dibromophenyl)methanol.
| Compound Name | 1-benzothiophen-7-yl-(2,5-dibromophenyl)methanol |
|---|---|
| PubChem CID | 115827334 |
| Molecular Formula | C15H10Br2OS |
| Molecular Weight | 398.12 g/mol |
| Exact Mass | 395.88 |
| IUPAC Name | 1-benzothiophen-7-yl-(2,5-dibromophenyl)methanol |
| SMILES | OC(c1cc(Br)ccc1Br)c1cccc2ccsc12 |
| InChI | InChI=1S/C15H10Br2OS/c16-10-4-5-13(17)12(8-10)14(18)11-3-1-2-9-6-7-19-15(9)11/h1-8,14,18H |
| InChIKey | KUIPYEXRGARVQL-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.12 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |