C14H9F6N — CID 115827734
1-(2-fluorophenyl)-N-methyl-1-(2,3,4,5,6-pentafluorophenyl)methanamine (PubChem CID 115827734) has the molecular formula C14H9F6N and a molecular weight of 305.22 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-methyl-1-(2,3,4,5,6-pentafluorophenyl)methanamine.
| Compound Name | 1-(2-fluorophenyl)-N-methyl-1-(2,3,4,5,6-pentafluorophenyl)methanamine |
|---|---|
| PubChem CID | 115827734 |
| Molecular Formula | C14H9F6N |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 1-(2-fluorophenyl)-N-methyl-1-(2,3,4,5,6-pentafluorophenyl)methanamine |
| SMILES | CNC(c1ccccc1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H9F6N/c1-21-14(6-4-2-3-5-7(6)15)8-9(16)11(18)13(20)12(19)10(8)17/h2-5,14,21H,1H3 |
| InChIKey | CDQLOGRQZGSYBD-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|