C18H14F9NO — CID 11582802
2-[4-[benzyl(2,2,2-trifluoroethyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 11582802) has the molecular formula C18H14F9NO and a molecular weight of 431.30 g/mol. Its IUPAC name is 2-[4-[benzyl(2,2,2-trifluoroethyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[benzyl(2,2,2-trifluoroethyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 11582802 |
| Molecular Formula | C18H14F9NO |
| Molecular Weight | 431.30 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 2-[4-[benzyl(2,2,2-trifluoroethyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(c1ccc(N(Cc2ccccc2)CC(F)(F)F)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H14F9NO/c19-15(20,21)11-28(10-12-4-2-1-3-5-12)14-8-6-13(7-9-14)16(29,17(22,23)24)18(25,26)27/h1-9,29H,10-11H2 |
| InChIKey | MUUGHUBMRJKYSW-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.30 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|