C10H17F3O3S — CID 115828338
1-(1,1-dioxothian-2-yl)-5,5,5-trifluoropentan-1-ol (PubChem CID 115828338) has the molecular formula C10H17F3O3S and a molecular weight of 274.30 g/mol. Its IUPAC name is 1-(1,1-dioxothian-2-yl)-5,5,5-trifluoropentan-1-ol.
| Compound Name | 1-(1,1-dioxothian-2-yl)-5,5,5-trifluoropentan-1-ol |
|---|---|
| PubChem CID | 115828338 |
| Molecular Formula | C10H17F3O3S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 1-(1,1-dioxothian-2-yl)-5,5,5-trifluoropentan-1-ol |
| SMILES | O=S1(=O)CCCCC1C(O)CCCC(F)(F)F |
| InChI | InChI=1S/C10H17F3O3S/c11-10(12,13)6-3-4-8(14)9-5-1-2-7-17(9,15)16/h8-9,14H,1-7H2 |
| InChIKey | RXDMGBHNDIBZGF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |