C16H24FNO2 — CID 115830037
N-ethyl-2-(3-fluoro-4-methoxyphenyl)-1-(5-methyloxolan-3-yl)ethanamine (PubChem CID 115830037) has the molecular formula C16H24FNO2 and a molecular weight of 281.37 g/mol. Its IUPAC name is N-ethyl-2-(3-fluoro-4-methoxyphenyl)-1-(5-methyloxolan-3-yl)ethanamine.
| Compound Name | N-ethyl-2-(3-fluoro-4-methoxyphenyl)-1-(5-methyloxolan-3-yl)ethanamine |
|---|---|
| PubChem CID | 115830037 |
| Molecular Formula | C16H24FNO2 |
| Molecular Weight | 281.37 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | N-ethyl-2-(3-fluoro-4-methoxyphenyl)-1-(5-methyloxolan-3-yl)ethanamine |
| SMILES | CCNC(Cc1ccc(OC)c(F)c1)C1COC(C)C1 |
| InChI | InChI=1S/C16H24FNO2/c1-4-18-15(13-7-11(2)20-10-13)9-12-5-6-16(19-3)14(17)8-12/h5-6,8,11,13,15,18H,4,7,9-10H2,1-3H3 |
| InChIKey | JDIKEYHICGUUQI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |