C27H36O5 — CID 11583015
ethyl 2-[3-[1-(4-cyclohexylphenyl)ethenyl]-1,2,5-trioxaspiro[5.5]undecan-9-ylidene]propanoate (PubChem CID 11583015) has the molecular formula C27H36O5 and a molecular weight of 440.58 g/mol. Its IUPAC name is ethyl 2-[3-[1-(4-cyclohexylphenyl)ethenyl]-1,2,5-trioxaspiro[5.5]undecan-9-ylidene]propanoate.
| Compound Name | ethyl 2-[3-[1-(4-cyclohexylphenyl)ethenyl]-1,2,5-trioxaspiro[5.5]undecan-9-ylidene]propanoate |
|---|---|
| PubChem CID | 11583015 |
| Molecular Formula | C27H36O5 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | ethyl 2-[3-[1-(4-cyclohexylphenyl)ethenyl]-1,2,5-trioxaspiro[5.5]undecan-9-ylidene]propanoate |
| SMILES | C=C(c1ccc(C2CCCCC2)cc1)C1COC2(CCC(=C(C)C(=O)OCC)CC2)OO1 |
| InChI | InChI=1S/C27H36O5/c1-4-29-26(28)20(3)22-14-16-27(17-15-22)30-18-25(31-32-27)19(2)21-10-12-24(13-11-21)23-8-6-5-7-9-23/h10-13,23,25H,2,4-9,14-18H2,1,3H3/b22-20- |
| InChIKey | PPKIMSRXQWFRHP-XDOYNYLZSA-N |
| XLogP | 6.24 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|