C11H14ClFO3S — CID 115831192
1-(2-chloro-3-fluorophenyl)-3-methylsulfonylbutan-2-ol (PubChem CID 115831192) has the molecular formula C11H14ClFO3S and a molecular weight of 280.75 g/mol. Its IUPAC name is 1-(2-chloro-3-fluorophenyl)-3-methylsulfonylbutan-2-ol.
| Compound Name | 1-(2-chloro-3-fluorophenyl)-3-methylsulfonylbutan-2-ol |
|---|---|
| PubChem CID | 115831192 |
| Molecular Formula | C11H14ClFO3S |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 1-(2-chloro-3-fluorophenyl)-3-methylsulfonylbutan-2-ol |
| SMILES | CC(C(O)Cc1cccc(F)c1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C11H14ClFO3S/c1-7(17(2,15)16)10(14)6-8-4-3-5-9(13)11(8)12/h3-5,7,10,14H,6H2,1-2H3 |
| InChIKey | PPGXBOXTARMOQS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |