C26H44O4Si — CID 11583209
(3E)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-[(1S,2R,6R)-2-(methoxymethoxy)-3-methyl-6-prop-1-en-2-ylcyclohex-3-en-1-yl]hexa-3,5-dien-2-one (PubChem CID 11583209) has the molecular formula C26H44O4Si and a molecular weight of 448.72 g/mol. Its IUPAC name is (3E)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-[(1S,2R,6R)-2-(methoxymethoxy)-3-methyl-6-prop-1-en-2-ylcyclohex-3-en-1-yl]hexa-3,5-dien-2-one.
| Compound Name | (3E)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-[(1S,2R,6R)-2-(methoxymethoxy)-3-methyl-6-prop-1-en-2-ylcyclohex-3-en-1-yl]hexa-3,5-dien-2-one |
|---|---|
| PubChem CID | 11583209 |
| Molecular Formula | C26H44O4Si |
| Molecular Weight | 448.72 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | (3E)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-[(1S,2R,6R)-2-(methoxymethoxy)-3-methyl-6-prop-1-en-2-ylcyclohex-3-en-1-yl]hexa-3,5-dien-2-one |
| SMILES | C=C/C(=C/C(=O)C[C@H]1[C@H](C(=C)C)CC=C(C)[C@@H]1OCOC)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H44O4Si/c1-11-21(14-15-30-31(9,10)26(5,6)7)16-22(27)17-24-23(19(2)3)13-12-20(4)25(24)29-18-28-8/h11-12,16,23-25H,1-2,13-15,17-18H2,3-10H3/b21-16-/t23-,24-,25-/m0/s1 |
| InChIKey | SVOUOLIORNNJBP-GQKQHZJYSA-N |
| XLogP | 6.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.72 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|