C15H12ClF3O2 — CID 115832813
1-(4-chloro-2,5-difluorophenyl)-2-(2-fluoro-3-methoxyphenyl)ethanol (PubChem CID 115832813) has the molecular formula C15H12ClF3O2 and a molecular weight of 316.71 g/mol. Its IUPAC name is 1-(4-chloro-2,5-difluorophenyl)-2-(2-fluoro-3-methoxyphenyl)ethanol.
| Compound Name | 1-(4-chloro-2,5-difluorophenyl)-2-(2-fluoro-3-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 115832813 |
| Molecular Formula | C15H12ClF3O2 |
| Molecular Weight | 316.71 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 1-(4-chloro-2,5-difluorophenyl)-2-(2-fluoro-3-methoxyphenyl)ethanol |
| SMILES | COc1cccc(CC(O)c2cc(F)c(Cl)cc2F)c1F |
| InChI | InChI=1S/C15H12ClF3O2/c1-21-14-4-2-3-8(15(14)19)5-13(20)9-6-12(18)10(16)7-11(9)17/h2-4,6-7,13,20H,5H2,1H3 |
| InChIKey | ZRMNLWZZVAHHDA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.71 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|