C14H29NO — CID 115832973
N-ethyl-1-(2,4,5-trimethyloxolan-3-yl)pentan-1-amine (PubChem CID 115832973) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is N-ethyl-1-(2,4,5-trimethyloxolan-3-yl)pentan-1-amine.
| Compound Name | N-ethyl-1-(2,4,5-trimethyloxolan-3-yl)pentan-1-amine |
|---|---|
| PubChem CID | 115832973 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | N-ethyl-1-(2,4,5-trimethyloxolan-3-yl)pentan-1-amine |
| SMILES | CCCCC(NCC)C1C(C)OC(C)C1C |
| InChI | InChI=1S/C14H29NO/c1-6-8-9-13(15-7-2)14-10(3)11(4)16-12(14)5/h10-15H,6-9H2,1-5H3 |
| InChIKey | HQWWIQKCGBFIQI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |