C14H21BrClN — CID 115834587
1-(5-bromo-2-chlorophenyl)-N-ethyl-4-methylpentan-1-amine (PubChem CID 115834587) has the molecular formula C14H21BrClN and a molecular weight of 318.69 g/mol. Its IUPAC name is 1-(5-bromo-2-chlorophenyl)-N-ethyl-4-methylpentan-1-amine.
| Compound Name | 1-(5-bromo-2-chlorophenyl)-N-ethyl-4-methylpentan-1-amine |
|---|---|
| PubChem CID | 115834587 |
| Molecular Formula | C14H21BrClN |
| Molecular Weight | 318.69 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 1-(5-bromo-2-chlorophenyl)-N-ethyl-4-methylpentan-1-amine |
| SMILES | CCNC(CCC(C)C)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C14H21BrClN/c1-4-17-14(8-5-10(2)3)12-9-11(15)6-7-13(12)16/h6-7,9-10,14,17H,4-5,8H2,1-3H3 |
| InChIKey | ZFNKXQTYVUQVRJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.69 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |