C14H15BrF2N2O — CID 115835068
1-(4-bromo-1-propylpyrazol-5-yl)-2-(2,6-difluorophenyl)ethanol (PubChem CID 115835068) has the molecular formula C14H15BrF2N2O and a molecular weight of 345.19 g/mol. Its IUPAC name is 1-(4-bromo-1-propylpyrazol-5-yl)-2-(2,6-difluorophenyl)ethanol.
| Compound Name | 1-(4-bromo-1-propylpyrazol-5-yl)-2-(2,6-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 115835068 |
| Molecular Formula | C14H15BrF2N2O |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 1-(4-bromo-1-propylpyrazol-5-yl)-2-(2,6-difluorophenyl)ethanol |
| SMILES | CCCn1ncc(Br)c1C(O)Cc1c(F)cccc1F |
| InChI | InChI=1S/C14H15BrF2N2O/c1-2-6-19-14(10(15)8-18-19)13(20)7-9-11(16)4-3-5-12(9)17/h3-5,8,13,20H,2,6-7H2,1H3 |
| InChIKey | WSNWINXRNSYRFA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |