C18H22F3N3O6S — CID 11583525
(5S)-5-methyl-5-[[4-[4-(2,2,2-trifluoroethoxy)phenoxy]piperidin-1-yl]sulfonylmethyl]imidazolidine-2,4-dione (PubChem CID 11583525) has the molecular formula C18H22F3N3O6S and a molecular weight of 465.45 g/mol. Its IUPAC name is (5S)-5-methyl-5-[[4-[4-(2,2,2-trifluoroethoxy)phenoxy]piperidin-1-yl]sulfonylmethyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-methyl-5-[[4-[4-(2,2,2-trifluoroethoxy)phenoxy]piperidin-1-yl]sulfonylmethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 11583525 |
| Molecular Formula | C18H22F3N3O6S |
| Molecular Weight | 465.45 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | (5S)-5-methyl-5-[[4-[4-(2,2,2-trifluoroethoxy)phenoxy]piperidin-1-yl]sulfonylmethyl]imidazolidine-2,4-dione |
| SMILES | C[C@]1(CS(=O)(=O)N2CCC(Oc3ccc(OCC(F)(F)F)cc3)CC2)NC(=O)NC1=O |
| InChI | InChI=1S/C18H22F3N3O6S/c1-17(15(25)22-16(26)23-17)11-31(27,28)24-8-6-14(7-9-24)30-13-4-2-12(3-5-13)29-10-18(19,20)21/h2-5,14H,6-11H2,1H3,(H2,22,23,25,26)/t17-/m1/s1 |
| InChIKey | YSUBCUHCVFDMIT-QGZVFWFLSA-N |
| XLogP | 1.40 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.45 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|