About 6-hydroxyhexyl (Z)-4-acetyloxy-3-(4-methylsulfonylphenyl)-2-phenylbut-2-enoate
6-hydroxyhexyl (Z)-4-acetyloxy-3-(4-methylsulfonylphenyl)-2-phenylbut-2-enoate (PubChem CID 11583709) has the molecular formula C25H30O7S
and a molecular weight of 474.58 g/mol. Its IUPAC name is 6-hydroxyhexyl (Z)-4-acetyloxy-3-(4-methylsulfonylphenyl)-2-phenylbut-2-enoate.
Molecular Properties
| Compound Name | 6-hydroxyhexyl (Z)-4-acetyloxy-3-(4-methylsulfonylphenyl)-2-phenylbut-2-enoate |
| PubChem CID | 11583709 |
| Molecular Formula | C25H30O7S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 6-hydroxyhexyl (Z)-4-acetyloxy-3-(4-methylsulfonylphenyl)-2-phenylbut-2-enoate |
| SMILES | CC(=O)OC/C(=C(\C(=O)OCCCCCCO)c1ccccc1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C25H30O7S/c1-19(27)32-18-23(20-12-14-22(15-13-20)33(2,29)30)24(21-10-6-5-7-11-21)25(28)31-17-9-4-3-8-16-26/h5-7,10-15,26H,3-4,8-9,16-18H2,1-2H3/b24-23+ |
| InChIKey | PBZLJIRGYXYIGO-WCWDXBQESA-N |
| XLogP | 3.66 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxyhexyl (Z)-4-acetyloxy-3-(4-methylsulfonylphenyl)-2-phenylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxyhexyl (Z)-4-acetyloxy-3-(4-methylsulfonylphenyl)-2-phenylbut-2-enoate?
The IUPAC name of 6-hydroxyhexyl (Z)-4-acetyloxy-3-(4-methylsulfonylphenyl)-2-phenylbut-2-enoate (CID 11583709) is 6-hydroxyhexyl (Z)-4-acetyloxy-3-(4-methylsulfonylphenyl)-2-phenylbut-2-enoate.
What is the SMILES notation for 6-hydroxyhexyl (Z)-4-acetyloxy-3-(4-methylsulfonylphenyl)-2-phenylbut-2-enoate?
The canonical SMILES for 6-hydroxyhexyl (Z)-4-acetyloxy-3-(4-methylsulfonylphenyl)-2-phenylbut-2-enoate is CC(=O)OC/C(=C(\C(=O)OCCCCCCO)c1ccccc1)c1ccc(S(C)(=O)=O)cc1.
What is the InChIKey of 6-hydroxyhexyl (Z)-4-acetyloxy-3-(4-methylsulfonylphenyl)-2-phenylbut-2-enoate?
The InChIKey is PBZLJIRGYXYIGO-WCWDXBQESA-N. The full InChI is InChI=1S/C25H30O7S/c1-19(27)32-18-23(20-12-14-22(15-13-20)33(2,29)30)24(21-10-6-5-7-11-21)25(28)31-17-9-4-3-8-16-26/h5-7,10-15,26H,3-4,8-9,16-18H2,1-2H3/b24-23+.
What are the key properties of 6-hydroxyhexyl (Z)-4-acetyloxy-3-(4-methylsulfonylphenyl)-2-phenylbut-2-enoate?
6-hydroxyhexyl (Z)-4-acetyloxy-3-(4-methylsulfonylphenyl)-2-phenylbut-2-enoate has a molecular weight of 474.58 g/mol, XLogP of 3.66, 12 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxyhexyl (Z)-4-acetyloxy-3-(4-methylsulfonylphenyl)-2-phenylbut-2-enoate is sourced from PubChem (CID 11583709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).