C28H21F2N3O3 — CID 11583918
4,6-bis(4-fluorophenyl)-N-(2-methoxyethyl)-5-pyridin-4-ylfuro[2,3-b]pyridine-2-carboxamide (PubChem CID 11583918) has the molecular formula C28H21F2N3O3 and a molecular weight of 485.49 g/mol. Its IUPAC name is 4,6-bis(4-fluorophenyl)-N-(2-methoxyethyl)-5-pyridin-4-ylfuro[2,3-b]pyridine-2-carboxamide.
| Compound Name | 4,6-bis(4-fluorophenyl)-N-(2-methoxyethyl)-5-pyridin-4-ylfuro[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 11583918 |
| Molecular Formula | C28H21F2N3O3 |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | 4,6-bis(4-fluorophenyl)-N-(2-methoxyethyl)-5-pyridin-4-ylfuro[2,3-b]pyridine-2-carboxamide |
| SMILES | COCCNC(=O)c1cc2c(-c3ccc(F)cc3)c(-c3ccncc3)c(-c3ccc(F)cc3)nc2o1 |
| InChI | InChI=1S/C28H21F2N3O3/c1-35-15-14-32-27(34)23-16-22-24(17-2-6-20(29)7-3-17)25(18-10-12-31-13-11-18)26(33-28(22)36-23)19-4-8-21(30)9-5-19/h2-13,16H,14-15H2,1H3,(H,32,34) |
| InChIKey | MXIAHQVKPVRMGT-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|