C14H21BrFN — CID 115839350
1-(5-bromo-2-fluorophenyl)-N,4-dimethylhexan-2-amine (PubChem CID 115839350) has the molecular formula C14H21BrFN and a molecular weight of 302.23 g/mol. Its IUPAC name is 1-(5-bromo-2-fluorophenyl)-N,4-dimethylhexan-2-amine.
| Compound Name | 1-(5-bromo-2-fluorophenyl)-N,4-dimethylhexan-2-amine |
|---|---|
| PubChem CID | 115839350 |
| Molecular Formula | C14H21BrFN |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 1-(5-bromo-2-fluorophenyl)-N,4-dimethylhexan-2-amine |
| SMILES | CCC(C)CC(Cc1cc(Br)ccc1F)NC |
| InChI | InChI=1S/C14H21BrFN/c1-4-10(2)7-13(17-3)9-11-8-12(15)5-6-14(11)16/h5-6,8,10,13,17H,4,7,9H2,1-3H3 |
| InChIKey | VSPOOCURTCVLHY-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.23 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |