C13H13ClFNOS — CID 115840443
2-(2-chloro-4-fluorophenyl)-1-(3-methoxythiophen-2-yl)ethanamine (PubChem CID 115840443) has the molecular formula C13H13ClFNOS and a molecular weight of 285.77 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenyl)-1-(3-methoxythiophen-2-yl)ethanamine.
| Compound Name | 2-(2-chloro-4-fluorophenyl)-1-(3-methoxythiophen-2-yl)ethanamine |
|---|---|
| PubChem CID | 115840443 |
| Molecular Formula | C13H13ClFNOS |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 2-(2-chloro-4-fluorophenyl)-1-(3-methoxythiophen-2-yl)ethanamine |
| SMILES | COc1ccsc1C(N)Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C13H13ClFNOS/c1-17-12-4-5-18-13(12)11(16)6-8-2-3-9(15)7-10(8)14/h2-5,7,11H,6,16H2,1H3 |
| InChIKey | FJPUZWHFDUUCGI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |