C31H44O5 — CID 11584123
(6R)-6-[(3R,3aR,6S,7R,9bR)-6-(2-carboxyethyl)-3a,6,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,4,7,8-hexahydrocyclopenta[a]naphthalen-3-yl]-2-methyl-3-methylidene-4-oxoheptanoic acid (PubChem CID 11584123) has the molecular formula C31H44O5 and a molecular weight of 496.69 g/mol. Its IUPAC name is (6R)-6-[(3R,3aR,6S,7R,9bR)-6-(2-carboxyethyl)-3a,6,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,4,7,8-hexahydrocyclopenta[a]naphthalen-3-yl]-2-methyl-3-methylidene-4-oxoheptanoic acid.
| Compound Name | (6R)-6-[(3R,3aR,6S,7R,9bR)-6-(2-carboxyethyl)-3a,6,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,4,7,8-hexahydrocyclopenta[a]naphthalen-3-yl]-2-methyl-3-methylidene-4-oxoheptanoic acid |
|---|---|
| PubChem CID | 11584123 |
| Molecular Formula | C31H44O5 |
| Molecular Weight | 496.69 g/mol |
| Exact Mass | 496.32 |
| IUPAC Name | (6R)-6-[(3R,3aR,6S,7R,9bR)-6-(2-carboxyethyl)-3a,6,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,4,7,8-hexahydrocyclopenta[a]naphthalen-3-yl]-2-methyl-3-methylidene-4-oxoheptanoic acid |
| SMILES | C=C(C(=O)C[C@@H](C)[C@H]1CC[C@@]2(C)C3=CC[C@H](C(=C)C)[C@](C)(CCC(=O)O)C3=CC[C@]12C)C(C)C(=O)O |
| InChI | InChI=1S/C31H44O5/c1-18(2)22-9-10-25-24(29(22,6)14-13-27(33)34)12-16-30(7)23(11-15-31(25,30)8)19(3)17-26(32)20(4)21(5)28(35)36/h10,12,19,21-23H,1,4,9,11,13-17H2,2-3,5-8H3,(H,33,34)(H,35,36)/t19-,21?,22-,23-,29+,30-,31+/m1/s1 |
| InChIKey | ZJMBUNAZIDNVOV-KUDMQRJLSA-N |
| XLogP | 7.00 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.69 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|