C14H15Cl2NS — CID 115842355
1-(2,6-dichlorophenyl)-2-(5-ethylthiophen-2-yl)ethanamine (PubChem CID 115842355) has the molecular formula C14H15Cl2NS and a molecular weight of 300.25 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-2-(5-ethylthiophen-2-yl)ethanamine.
| Compound Name | 1-(2,6-dichlorophenyl)-2-(5-ethylthiophen-2-yl)ethanamine |
|---|---|
| PubChem CID | 115842355 |
| Molecular Formula | C14H15Cl2NS |
| Molecular Weight | 300.25 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-2-(5-ethylthiophen-2-yl)ethanamine |
| SMILES | CCc1ccc(CC(N)c2c(Cl)cccc2Cl)s1 |
| InChI | InChI=1S/C14H15Cl2NS/c1-2-9-6-7-10(18-9)8-13(17)14-11(15)4-3-5-12(14)16/h3-7,13H,2,8,17H2,1H3 |
| InChIKey | VEZRVSBPSVYRQW-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.25 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |