C18H25NOS — CID 115842505
2-(5-ethylthiophen-2-yl)-N-methyl-1-(3-propoxyphenyl)ethanamine (PubChem CID 115842505) has the molecular formula C18H25NOS and a molecular weight of 303.47 g/mol. Its IUPAC name is 2-(5-ethylthiophen-2-yl)-N-methyl-1-(3-propoxyphenyl)ethanamine.
| Compound Name | 2-(5-ethylthiophen-2-yl)-N-methyl-1-(3-propoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 115842505 |
| Molecular Formula | C18H25NOS |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 2-(5-ethylthiophen-2-yl)-N-methyl-1-(3-propoxyphenyl)ethanamine |
| SMILES | CCCOc1cccc(C(Cc2ccc(CC)s2)NC)c1 |
| InChI | InChI=1S/C18H25NOS/c1-4-11-20-15-8-6-7-14(12-15)18(19-3)13-17-10-9-16(5-2)21-17/h6-10,12,18-19H,4-5,11,13H2,1-3H3 |
| InChIKey | ZLKHFGLNQUQEEB-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |