C15H23BrFN — CID 115843078
1-(2-bromo-4-fluorophenyl)-N,3-diethylpentan-2-amine (PubChem CID 115843078) has the molecular formula C15H23BrFN and a molecular weight of 316.26 g/mol. Its IUPAC name is 1-(2-bromo-4-fluorophenyl)-N,3-diethylpentan-2-amine.
| Compound Name | 1-(2-bromo-4-fluorophenyl)-N,3-diethylpentan-2-amine |
|---|---|
| PubChem CID | 115843078 |
| Molecular Formula | C15H23BrFN |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 1-(2-bromo-4-fluorophenyl)-N,3-diethylpentan-2-amine |
| SMILES | CCNC(Cc1ccc(F)cc1Br)C(CC)CC |
| InChI | InChI=1S/C15H23BrFN/c1-4-11(5-2)15(18-6-3)9-12-7-8-13(17)10-14(12)16/h7-8,10-11,15,18H,4-6,9H2,1-3H3 |
| InChIKey | WOXYOQIOUOGATI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |