C16H19BrFNS — CID 115843203
2-(2-bromo-4-fluorophenyl)-N-ethyl-1-(5-ethylthiophen-2-yl)ethanamine (PubChem CID 115843203) has the molecular formula C16H19BrFNS and a molecular weight of 356.30 g/mol. Its IUPAC name is 2-(2-bromo-4-fluorophenyl)-N-ethyl-1-(5-ethylthiophen-2-yl)ethanamine.
| Compound Name | 2-(2-bromo-4-fluorophenyl)-N-ethyl-1-(5-ethylthiophen-2-yl)ethanamine |
|---|---|
| PubChem CID | 115843203 |
| Molecular Formula | C16H19BrFNS |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 2-(2-bromo-4-fluorophenyl)-N-ethyl-1-(5-ethylthiophen-2-yl)ethanamine |
| SMILES | CCNC(Cc1ccc(F)cc1Br)c1ccc(CC)s1 |
| InChI | InChI=1S/C16H19BrFNS/c1-3-13-7-8-16(20-13)15(19-4-2)9-11-5-6-12(18)10-14(11)17/h5-8,10,15,19H,3-4,9H2,1-2H3 |
| InChIKey | LGLPUWQXLWKTFY-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |