C16H23Cl2NO — CID 115843397
N-[2-(3,4-dichlorophenyl)-1-(oxan-2-yl)ethyl]propan-1-amine (PubChem CID 115843397) has the molecular formula C16H23Cl2NO and a molecular weight of 316.27 g/mol. Its IUPAC name is N-[2-(3,4-dichlorophenyl)-1-(oxan-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(3,4-dichlorophenyl)-1-(oxan-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 115843397 |
| Molecular Formula | C16H23Cl2NO |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | N-[2-(3,4-dichlorophenyl)-1-(oxan-2-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccc(Cl)c(Cl)c1)C1CCCCO1 |
| InChI | InChI=1S/C16H23Cl2NO/c1-2-8-19-15(16-5-3-4-9-20-16)11-12-6-7-13(17)14(18)10-12/h6-7,10,15-16,19H,2-5,8-9,11H2,1H3 |
| InChIKey | FEHKGJPXRXJNPQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |