C17H23BrFN — CID 115843516
1-(7-bicyclo[4.1.0]heptanyl)-2-(2-bromo-5-fluorophenyl)-N-ethylethanamine (PubChem CID 115843516) has the molecular formula C17H23BrFN and a molecular weight of 340.28 g/mol. Its IUPAC name is 1-(7-bicyclo[4.1.0]heptanyl)-2-(2-bromo-5-fluorophenyl)-N-ethylethanamine.
| Compound Name | 1-(7-bicyclo[4.1.0]heptanyl)-2-(2-bromo-5-fluorophenyl)-N-ethylethanamine |
|---|---|
| PubChem CID | 115843516 |
| Molecular Formula | C17H23BrFN |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 1-(7-bicyclo[4.1.0]heptanyl)-2-(2-bromo-5-fluorophenyl)-N-ethylethanamine |
| SMILES | CCNC(Cc1cc(F)ccc1Br)C1C2CCCCC21 |
| InChI | InChI=1S/C17H23BrFN/c1-2-20-16(17-13-5-3-4-6-14(13)17)10-11-9-12(19)7-8-15(11)18/h7-9,13-14,16-17,20H,2-6,10H2,1H3 |
| InChIKey | AXBFUUJIECPKND-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |