C15H17BrFNO — CID 115843751
2-(2-bromo-5-fluorophenyl)-N-ethyl-1-(5-methylfuran-3-yl)ethanamine (PubChem CID 115843751) has the molecular formula C15H17BrFNO and a molecular weight of 326.21 g/mol. Its IUPAC name is 2-(2-bromo-5-fluorophenyl)-N-ethyl-1-(5-methylfuran-3-yl)ethanamine.
| Compound Name | 2-(2-bromo-5-fluorophenyl)-N-ethyl-1-(5-methylfuran-3-yl)ethanamine |
|---|---|
| PubChem CID | 115843751 |
| Molecular Formula | C15H17BrFNO |
| Molecular Weight | 326.21 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 2-(2-bromo-5-fluorophenyl)-N-ethyl-1-(5-methylfuran-3-yl)ethanamine |
| SMILES | CCNC(Cc1cc(F)ccc1Br)c1coc(C)c1 |
| InChI | InChI=1S/C15H17BrFNO/c1-3-18-15(12-6-10(2)19-9-12)8-11-7-13(17)4-5-14(11)16/h4-7,9,15,18H,3,8H2,1-2H3 |
| InChIKey | YQFHAJCBUIHXHQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.21 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |