C15H21BrFNO — CID 115844482
1-(4-bromo-2-fluorophenyl)-N-methyl-4-(oxolan-2-yl)butan-2-amine (PubChem CID 115844482) has the molecular formula C15H21BrFNO and a molecular weight of 330.24 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)-N-methyl-4-(oxolan-2-yl)butan-2-amine.
| Compound Name | 1-(4-bromo-2-fluorophenyl)-N-methyl-4-(oxolan-2-yl)butan-2-amine |
|---|---|
| PubChem CID | 115844482 |
| Molecular Formula | C15H21BrFNO |
| Molecular Weight | 330.24 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)-N-methyl-4-(oxolan-2-yl)butan-2-amine |
| SMILES | CNC(CCC1CCCO1)Cc1ccc(Br)cc1F |
| InChI | InChI=1S/C15H21BrFNO/c1-18-13(6-7-14-3-2-8-19-14)9-11-4-5-12(16)10-15(11)17/h4-5,10,13-14,18H,2-3,6-9H2,1H3 |
| InChIKey | ZMZYMMBPCBLJPK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.24 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |