C26H23F3N6OS — CID 11584473
6-ethoxy-4-piperazin-1-yl-11-(4-pyrrol-1-ylphenyl)-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 11584473) has the molecular formula C26H23F3N6OS and a molecular weight of 524.57 g/mol. Its IUPAC name is 6-ethoxy-4-piperazin-1-yl-11-(4-pyrrol-1-ylphenyl)-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 6-ethoxy-4-piperazin-1-yl-11-(4-pyrrol-1-ylphenyl)-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 11584473 |
| Molecular Formula | C26H23F3N6OS |
| Molecular Weight | 524.57 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | 6-ethoxy-4-piperazin-1-yl-11-(4-pyrrol-1-ylphenyl)-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | CCOc1nc(N2CCNCC2)nc2c1sc1nc(-c3ccc(-n4cccc4)cc3)cc(C(F)(F)F)c12 |
| InChI | InChI=1S/C26H23F3N6OS/c1-2-36-23-22-21(32-25(33-23)35-13-9-30-10-14-35)20-18(26(27,28)29)15-19(31-24(20)37-22)16-5-7-17(8-6-16)34-11-3-4-12-34/h3-8,11-12,15,30H,2,9-10,13-14H2,1H3 |
| InChIKey | CJISKCAQBZGTLB-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.57 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_G(4)', 'substructure': 'N/A'} |
|---|