C14H22ClNO3S — CID 115844824
1-(5-chloro-2-methoxyphenyl)-N-ethyl-3-methylsulfonylbutan-2-amine (PubChem CID 115844824) has the molecular formula C14H22ClNO3S and a molecular weight of 319.85 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-N-ethyl-3-methylsulfonylbutan-2-amine.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-N-ethyl-3-methylsulfonylbutan-2-amine |
|---|---|
| PubChem CID | 115844824 |
| Molecular Formula | C14H22ClNO3S |
| Molecular Weight | 319.85 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-N-ethyl-3-methylsulfonylbutan-2-amine |
| SMILES | CCNC(Cc1cc(Cl)ccc1OC)C(C)S(C)(=O)=O |
| InChI | InChI=1S/C14H22ClNO3S/c1-5-16-13(10(2)20(4,17)18)9-11-8-12(15)6-7-14(11)19-3/h6-8,10,13,16H,5,9H2,1-4H3 |
| InChIKey | DELWZRUNIWNUNN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.85 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |