C15H22ClNO2 — CID 115844831
2-(5-chloro-2-methoxyphenyl)-N-methyl-1-(2-methyloxolan-3-yl)ethanamine (PubChem CID 115844831) has the molecular formula C15H22ClNO2 and a molecular weight of 283.80 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxyphenyl)-N-methyl-1-(2-methyloxolan-3-yl)ethanamine.
| Compound Name | 2-(5-chloro-2-methoxyphenyl)-N-methyl-1-(2-methyloxolan-3-yl)ethanamine |
|---|---|
| PubChem CID | 115844831 |
| Molecular Formula | C15H22ClNO2 |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 2-(5-chloro-2-methoxyphenyl)-N-methyl-1-(2-methyloxolan-3-yl)ethanamine |
| SMILES | CNC(Cc1cc(Cl)ccc1OC)C1CCOC1C |
| InChI | InChI=1S/C15H22ClNO2/c1-10-13(6-7-19-10)14(17-2)9-11-8-12(16)4-5-15(11)18-3/h4-5,8,10,13-14,17H,6-7,9H2,1-3H3 |
| InChIKey | GNDHXTMPAQUBRQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |