C22H16Br2N4Zn — CID 11584913
zinc 8,18-dibromo-3,3-dimethyl-2H-porphyrin-23,24-diide (PubChem CID 11584913) has the molecular formula C22H16Br2N4Zn and a molecular weight of 561.60 g/mol. Its IUPAC name is zinc 8,18-dibromo-3,3-dimethyl-2H-porphyrin-23,24-diide.
| Compound Name | zinc 8,18-dibromo-3,3-dimethyl-2H-porphyrin-23,24-diide |
|---|---|
| PubChem CID | 11584913 |
| Molecular Formula | C22H16Br2N4Zn |
| Molecular Weight | 561.60 g/mol |
| Exact Mass | 557.90 |
| IUPAC Name | zinc 8,18-dibromo-3,3-dimethyl-2H-porphyrin-23,24-diide |
| SMILES | CC1(C)Cc2cc3[n-]c(cc3Br)cc3ccc(cc4nc(cc1n2)C=C4Br)[n-]3.[Zn+2] |
| InChI | InChI=1S/C22H16Br2N4.Zn/c1-22(2)11-16-9-20-17(23)6-14(26-20)5-12-3-4-13(25-12)8-19-18(24)7-15(27-19)10-21(22)28-16;/h3-10H,11H2,1-2H3;/q-2;+2/b12-5-,13-8-,14-5-,15-10-,16-9-,19-8-,20-9-,21-10-; |
| InChIKey | WEYNDTYANMGBFX-HBWOBTBJSA-N |
| XLogP | 5.75 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.60 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|