C17H18BrNS2 — CID 115849242
N-[1-(1-benzothiophen-2-yl)-2-(3-bromothiophen-2-yl)ethyl]propan-1-amine (PubChem CID 115849242) has the molecular formula C17H18BrNS2 and a molecular weight of 380.38 g/mol. Its IUPAC name is N-[1-(1-benzothiophen-2-yl)-2-(3-bromothiophen-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[1-(1-benzothiophen-2-yl)-2-(3-bromothiophen-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 115849242 |
| Molecular Formula | C17H18BrNS2 |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | N-[1-(1-benzothiophen-2-yl)-2-(3-bromothiophen-2-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1sccc1Br)c1cc2ccccc2s1 |
| InChI | InChI=1S/C17H18BrNS2/c1-2-8-19-14(11-16-13(18)7-9-20-16)17-10-12-5-3-4-6-15(12)21-17/h3-7,9-10,14,19H,2,8,11H2,1H3 |
| InChIKey | OZFUZXDCOYXECC-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |