C19H27NO — CID 115849308
N-ethyl-4-phenyl-1-(2,4,5-trimethylfuran-3-yl)butan-1-amine (PubChem CID 115849308) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is N-ethyl-4-phenyl-1-(2,4,5-trimethylfuran-3-yl)butan-1-amine.
| Compound Name | N-ethyl-4-phenyl-1-(2,4,5-trimethylfuran-3-yl)butan-1-amine |
|---|---|
| PubChem CID | 115849308 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | N-ethyl-4-phenyl-1-(2,4,5-trimethylfuran-3-yl)butan-1-amine |
| SMILES | CCNC(CCCc1ccccc1)c1c(C)oc(C)c1C |
| InChI | InChI=1S/C19H27NO/c1-5-20-18(19-14(2)15(3)21-16(19)4)13-9-12-17-10-7-6-8-11-17/h6-8,10-11,18,20H,5,9,12-13H2,1-4H3 |
| InChIKey | XIKPGVOBNCIRBV-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |