C27H34Cl2N4O3S — CID 11584938
7-[1-ethylsulfonyl-5-(piperidin-4-ylmethoxy)-2,3-dihydroindol-2-yl]naphthalene-2-carboximidamide;dihydrochloride (PubChem CID 11584938) has the molecular formula C27H34Cl2N4O3S and a molecular weight of 565.57 g/mol. Its IUPAC name is 7-[1-ethylsulfonyl-5-(piperidin-4-ylmethoxy)-2,3-dihydroindol-2-yl]naphthalene-2-carboximidamide;dihydrochloride.
| Compound Name | 7-[1-ethylsulfonyl-5-(piperidin-4-ylmethoxy)-2,3-dihydroindol-2-yl]naphthalene-2-carboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 11584938 |
| Molecular Formula | C27H34Cl2N4O3S |
| Molecular Weight | 565.57 g/mol |
| Exact Mass | 564.17 |
| IUPAC Name | 7-[1-ethylsulfonyl-5-(piperidin-4-ylmethoxy)-2,3-dihydroindol-2-yl]naphthalene-2-carboximidamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc2ccc(C3Cc4cc(OCC5CCNCC5)ccc4N3S(=O)(=O)CC)cc2c1 |
| InChI | InChI=1S/C27H32N4O3S.2ClH/c1-2-35(32,33)31-25-8-7-24(34-17-18-9-11-30-12-10-18)15-23(25)16-26(31)20-5-3-19-4-6-21(27(28)29)14-22(19)13-20;;/h3-8,13-15,18,26,30H,2,9-12,16-17H2,1H3,(H3,28,29);2*1H |
| InChIKey | BTNKFIWMURQSGX-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 108.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.57 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|