C30H24F6N2O3 — CID 11585010
1,1,1,3,3,3-hexafluoro-2-[2-methyl-1-[[5-methyl-2-(3-phenylmethoxyphenyl)-1,3-oxazol-4-yl]methyl]indol-5-yl]propan-2-ol (PubChem CID 11585010) has the molecular formula C30H24F6N2O3 and a molecular weight of 574.52 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[2-methyl-1-[[5-methyl-2-(3-phenylmethoxyphenyl)-1,3-oxazol-4-yl]methyl]indol-5-yl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[2-methyl-1-[[5-methyl-2-(3-phenylmethoxyphenyl)-1,3-oxazol-4-yl]methyl]indol-5-yl]propan-2-ol |
|---|---|
| PubChem CID | 11585010 |
| Molecular Formula | C30H24F6N2O3 |
| Molecular Weight | 574.52 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[2-methyl-1-[[5-methyl-2-(3-phenylmethoxyphenyl)-1,3-oxazol-4-yl]methyl]indol-5-yl]propan-2-ol |
| SMILES | Cc1oc(-c2cccc(OCc3ccccc3)c2)nc1Cn1c(C)cc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C30H24F6N2O3/c1-18-13-22-14-23(28(39,29(31,32)33)30(34,35)36)11-12-26(22)38(18)16-25-19(2)41-27(37-25)21-9-6-10-24(15-21)40-17-20-7-4-3-5-8-20/h3-15,39H,16-17H2,1-2H3 |
| InChIKey | ATQYBNIGMWAGEY-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.52 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |