C21H17Cl3N4O5S2 — CID 11585020
2-[2-(4-methoxyphenyl)-4-oxo-3-[5-sulfanylidene-3-[(2,4,6-trichlorophenoxy)methyl]-1H-1,2,4-triazol-4-yl]-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 11585020) has the molecular formula C21H17Cl3N4O5S2 and a molecular weight of 575.88 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenyl)-4-oxo-3-[5-sulfanylidene-3-[(2,4,6-trichlorophenoxy)methyl]-1H-1,2,4-triazol-4-yl]-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-(4-methoxyphenyl)-4-oxo-3-[5-sulfanylidene-3-[(2,4,6-trichlorophenoxy)methyl]-1H-1,2,4-triazol-4-yl]-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 11585020 |
| Molecular Formula | C21H17Cl3N4O5S2 |
| Molecular Weight | 575.88 g/mol |
| Exact Mass | 573.97 |
| IUPAC Name | 2-[2-(4-methoxyphenyl)-4-oxo-3-[5-sulfanylidene-3-[(2,4,6-trichlorophenoxy)methyl]-1H-1,2,4-triazol-4-yl]-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | COc1ccc(C2SC(CC(=O)O)C(=O)N2n2c(COc3c(Cl)cc(Cl)cc3Cl)n[nH]c2=S)cc1 |
| InChI | InChI=1S/C21H17Cl3N4O5S2/c1-32-12-4-2-10(3-5-12)20-28(19(31)15(35-20)8-17(29)30)27-16(25-26-21(27)34)9-33-18-13(23)6-11(22)7-14(18)24/h2-7,15,20H,8-9H2,1H3,(H,26,34)(H,29,30) |
| InChIKey | MWFQCDNVFRDOPE-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.88 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|