C13H11ClF3NOS — CID 115850814
1-(5-chlorothiophen-2-yl)-N-methyl-1-[2-(trifluoromethoxy)phenyl]methanamine (PubChem CID 115850814) has the molecular formula C13H11ClF3NOS and a molecular weight of 321.75 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-N-methyl-1-[2-(trifluoromethoxy)phenyl]methanamine.
| Compound Name | 1-(5-chlorothiophen-2-yl)-N-methyl-1-[2-(trifluoromethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 115850814 |
| Molecular Formula | C13H11ClF3NOS |
| Molecular Weight | 321.75 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-N-methyl-1-[2-(trifluoromethoxy)phenyl]methanamine |
| SMILES | CNC(c1ccc(Cl)s1)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C13H11ClF3NOS/c1-18-12(10-6-7-11(14)20-10)8-4-2-3-5-9(8)19-13(15,16)17/h2-7,12,18H,1H3 |
| InChIKey | RUFVZFILXFXOLE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.75 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |