C15H13Cl4N — CID 115851351
N-[bis(2,3-dichlorophenyl)methyl]ethanamine (PubChem CID 115851351) has the molecular formula C15H13Cl4N and a molecular weight of 349.09 g/mol. Its IUPAC name is N-[bis(2,3-dichlorophenyl)methyl]ethanamine.
| Compound Name | N-[bis(2,3-dichlorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 115851351 |
| Molecular Formula | C15H13Cl4N |
| Molecular Weight | 349.09 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | N-[bis(2,3-dichlorophenyl)methyl]ethanamine |
| SMILES | CCNC(c1cccc(Cl)c1Cl)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H13Cl4N/c1-2-20-15(9-5-3-7-11(16)13(9)18)10-6-4-8-12(17)14(10)19/h3-8,15,20H,2H2,1H3 |
| InChIKey | OJQIZBXDECKHOM-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.09 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |