C17H17IN2S — CID 115853076
N-[(5-iodothiophen-3-yl)-isoquinolin-5-ylmethyl]propan-1-amine (PubChem CID 115853076) has the molecular formula C17H17IN2S and a molecular weight of 408.31 g/mol. Its IUPAC name is N-[(5-iodothiophen-3-yl)-isoquinolin-5-ylmethyl]propan-1-amine.
| Compound Name | N-[(5-iodothiophen-3-yl)-isoquinolin-5-ylmethyl]propan-1-amine |
|---|---|
| PubChem CID | 115853076 |
| Molecular Formula | C17H17IN2S |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | N-[(5-iodothiophen-3-yl)-isoquinolin-5-ylmethyl]propan-1-amine |
| SMILES | CCCNC(c1csc(I)c1)c1cccc2cnccc12 |
| InChI | InChI=1S/C17H17IN2S/c1-2-7-20-17(13-9-16(18)21-11-13)15-5-3-4-12-10-19-8-6-14(12)15/h3-6,8-11,17,20H,2,7H2,1H3 |
| InChIKey | ICQGYIJOWNDCJI-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|