C15H31NO — CID 115855755
N-ethyl-3,4,4-trimethyl-1-(oxan-4-yl)pentan-1-amine (PubChem CID 115855755) has the molecular formula C15H31NO and a molecular weight of 241.42 g/mol. Its IUPAC name is N-ethyl-3,4,4-trimethyl-1-(oxan-4-yl)pentan-1-amine.
| Compound Name | N-ethyl-3,4,4-trimethyl-1-(oxan-4-yl)pentan-1-amine |
|---|---|
| PubChem CID | 115855755 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | N-ethyl-3,4,4-trimethyl-1-(oxan-4-yl)pentan-1-amine |
| SMILES | CCNC(CC(C)C(C)(C)C)C1CCOCC1 |
| InChI | InChI=1S/C15H31NO/c1-6-16-14(11-12(2)15(3,4)5)13-7-9-17-10-8-13/h12-14,16H,6-11H2,1-5H3 |
| InChIKey | QNOQFVNTYUZZSN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |