C36H52O8S2 — CID 11585589
[(8E)-13-(benzenesulfonyl)-5,12-bis(methoxymethoxy)-2,6,11,15-tetramethylhexadeca-2,8,14-trien-4-yl]sulfonylbenzene (PubChem CID 11585589) has the molecular formula C36H52O8S2 and a molecular weight of 676.94 g/mol. Its IUPAC name is [(8E)-13-(benzenesulfonyl)-5,12-bis(methoxymethoxy)-2,6,11,15-tetramethylhexadeca-2,8,14-trien-4-yl]sulfonylbenzene.
| Compound Name | [(8E)-13-(benzenesulfonyl)-5,12-bis(methoxymethoxy)-2,6,11,15-tetramethylhexadeca-2,8,14-trien-4-yl]sulfonylbenzene |
|---|---|
| PubChem CID | 11585589 |
| Molecular Formula | C36H52O8S2 |
| Molecular Weight | 676.94 g/mol |
| Exact Mass | 676.31 |
| IUPAC Name | [(8E)-13-(benzenesulfonyl)-5,12-bis(methoxymethoxy)-2,6,11,15-tetramethylhexadeca-2,8,14-trien-4-yl]sulfonylbenzene |
| SMILES | COCOC(C(C)C/C=C/CC(C)C(OCOC)C(C=C(C)C)S(=O)(=O)c1ccccc1)C(C=C(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C36H52O8S2/c1-27(2)23-33(45(37,38)31-19-11-9-12-20-31)35(43-25-41-7)29(5)17-15-16-18-30(6)36(44-26-42-8)34(24-28(3)4)46(39,40)32-21-13-10-14-22-32/h9-16,19-24,29-30,33-36H,17-18,25-26H2,1-8H3/b16-15+ |
| InChIKey | BIASDFQCCOUKFI-FOCLMDBBSA-N |
| XLogP | 7.19 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.94 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|