C42H72N2O5 — CID 11585619
bis(1,2,2,6,6-pentamethylpiperidin-3-yl) 2-butyl-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]propanedioate (PubChem CID 11585619) has the molecular formula C42H72N2O5 and a molecular weight of 685.05 g/mol. Its IUPAC name is bis(1,2,2,6,6-pentamethylpiperidin-3-yl) 2-butyl-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]propanedioate.
| Compound Name | bis(1,2,2,6,6-pentamethylpiperidin-3-yl) 2-butyl-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 11585619 |
| Molecular Formula | C42H72N2O5 |
| Molecular Weight | 685.05 g/mol |
| Exact Mass | 684.54 |
| IUPAC Name | bis(1,2,2,6,6-pentamethylpiperidin-3-yl) 2-butyl-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]propanedioate |
| SMILES | CCCCC(Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1O)(C(=O)OC1CCC(C)(C)N(C)C1(C)C)C(=O)OC1CCC(C)(C)N(C)C1(C)C |
| InChI | InChI=1S/C42H72N2O5/c1-18-19-22-42(34(46)48-31-20-23-38(8,9)43(16)40(31,12)13,35(47)49-32-21-24-39(10,11)44(17)41(32,14)15)27-28-25-29(36(2,3)4)26-30(33(28)45)37(5,6)7/h25-26,31-32,45H,18-24,27H2,1-17H3 |
| InChIKey | RYROHTOBUZBHFG-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.05 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|