C44H48N2O6 — CID 11585664
2,9-bis[2,6-bis(pent-4-enoxy)phenoxy]-1,10-phenanthroline (PubChem CID 11585664) has the molecular formula C44H48N2O6 and a molecular weight of 700.88 g/mol. Its IUPAC name is 2,9-bis[2,6-bis(pent-4-enoxy)phenoxy]-1,10-phenanthroline.
| Compound Name | 2,9-bis[2,6-bis(pent-4-enoxy)phenoxy]-1,10-phenanthroline |
|---|---|
| PubChem CID | 11585664 |
| Molecular Formula | C44H48N2O6 |
| Molecular Weight | 700.88 g/mol |
| Exact Mass | 700.35 |
| IUPAC Name | 2,9-bis[2,6-bis(pent-4-enoxy)phenoxy]-1,10-phenanthroline |
| SMILES | C=CCCCOc1cccc(OCCCC=C)c1Oc1ccc2ccc3ccc(Oc4c(OCCCC=C)cccc4OCCCC=C)nc3c2n1 |
| InChI | InChI=1S/C44H48N2O6/c1-5-9-13-29-47-35-19-17-20-36(48-30-14-10-6-2)43(35)51-39-27-25-33-23-24-34-26-28-40(46-42(34)41(33)45-39)52-44-37(49-31-15-11-7-3)21-18-22-38(44)50-32-16-12-8-4/h5-8,17-28H,1-4,9-16,29-32H2 |
| InChIKey | NMHXIDGWDOJDLZ-UHFFFAOYSA-N |
| XLogP | 11.75 |
| TPSA | 81.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.88 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|