C15H17Cl2NS — CID 115857101
1-(2,3-dichlorophenyl)-N-ethyl-3-thiophen-3-ylpropan-1-amine (PubChem CID 115857101) has the molecular formula C15H17Cl2NS and a molecular weight of 314.28 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-N-ethyl-3-thiophen-3-ylpropan-1-amine.
| Compound Name | 1-(2,3-dichlorophenyl)-N-ethyl-3-thiophen-3-ylpropan-1-amine |
|---|---|
| PubChem CID | 115857101 |
| Molecular Formula | C15H17Cl2NS |
| Molecular Weight | 314.28 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-N-ethyl-3-thiophen-3-ylpropan-1-amine |
| SMILES | CCNC(CCc1ccsc1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H17Cl2NS/c1-2-18-14(7-6-11-8-9-19-10-11)12-4-3-5-13(16)15(12)17/h3-5,8-10,14,18H,2,6-7H2,1H3 |
| InChIKey | ILZSIVLQXQRHQN-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.28 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |