C17H22Cl2N2O3 — CID 1158591
4,5-dichloro-2-[(2,2,6,6-tetramethylpiperidin-4-yl)carbamoyl]benzoic acid (PubChem CID 1158591) has the molecular formula C17H22Cl2N2O3 and a molecular weight of 373.28 g/mol. Its IUPAC name is 4,5-dichloro-2-[(2,2,6,6-tetramethylpiperidin-4-yl)carbamoyl]benzoic acid.
| Compound Name | 4,5-dichloro-2-[(2,2,6,6-tetramethylpiperidin-4-yl)carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 1158591 |
| Molecular Formula | C17H22Cl2N2O3 |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 4,5-dichloro-2-[(2,2,6,6-tetramethylpiperidin-4-yl)carbamoyl]benzoic acid |
| SMILES | CC1(C)CC(NC(=O)c2cc(Cl)c(Cl)cc2C(=O)O)CC(C)(C)N1 |
| InChI | InChI=1S/C17H22Cl2N2O3/c1-16(2)7-9(8-17(3,4)21-16)20-14(22)10-5-12(18)13(19)6-11(10)15(23)24/h5-6,9,21H,7-8H2,1-4H3,(H,20,22)(H,23,24) |
| InChIKey | XNAGNGGNPZOOBP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |