About CID 11585945
CID 11585945 (PubChem CID 11585945) has the molecular formula C11H17N3O
and a molecular weight of 207.28 g/mol.
Molecular Properties
| Compound Name | CID 11585945 |
| PubChem CID | 11585945 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | — |
| SMILES | CC(C)N1[C]N(C(=O)N2CCCC2)C=C1 |
| InChI | InChI=1S/C11H17N3O/c1-10(2)13-7-8-14(9-13)11(15)12-5-3-4-6-12/h7-8,10H,3-6H2,1-2H3 |
| InChIKey | ZNYMQPORAIUDRM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 11585945 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11585945?
The IUPAC name of CID 11585945 (CID 11585945) is not available.
What is the SMILES notation for CID 11585945?
The canonical SMILES for CID 11585945 is CC(C)N1[C]N(C(=O)N2CCCC2)C=C1.
What is the InChIKey of CID 11585945?
The InChIKey is ZNYMQPORAIUDRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O/c1-10(2)13-7-8-14(9-13)11(15)12-5-3-4-6-12/h7-8,10H,3-6H2,1-2H3.
What are the key properties of CID 11585945?
CID 11585945 has a molecular weight of 207.28 g/mol, XLogP of 1.70, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11585945 is sourced from PubChem (CID 11585945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).