C13H15BrFN — CID 115859654
1-(2-bromo-3-fluorophenyl)-N-ethylpent-4-yn-1-amine (PubChem CID 115859654) has the molecular formula C13H15BrFN and a molecular weight of 284.17 g/mol. Its IUPAC name is 1-(2-bromo-3-fluorophenyl)-N-ethylpent-4-yn-1-amine.
| Compound Name | 1-(2-bromo-3-fluorophenyl)-N-ethylpent-4-yn-1-amine |
|---|---|
| PubChem CID | 115859654 |
| Molecular Formula | C13H15BrFN |
| Molecular Weight | 284.17 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 1-(2-bromo-3-fluorophenyl)-N-ethylpent-4-yn-1-amine |
| SMILES | C#CCCC(NCC)c1cccc(F)c1Br |
| InChI | InChI=1S/C13H15BrFN/c1-3-5-9-12(16-4-2)10-7-6-8-11(15)13(10)14/h1,6-8,12,16H,4-5,9H2,2H3 |
| InChIKey | MOFUPAWQAKKOAA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.17 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|